|
@@ -1,22 +1,23 @@
|
|
use crate::{
|
|
use crate::{
|
|
- interrupt::{
|
|
|
|
|
|
+ platform::{
|
|
Apic,
|
|
Apic,
|
|
InterruptModel,
|
|
InterruptModel,
|
|
InterruptSourceOverride,
|
|
InterruptSourceOverride,
|
|
IoApic,
|
|
IoApic,
|
|
|
|
+ LocalInterruptLine,
|
|
NmiLine,
|
|
NmiLine,
|
|
NmiProcessor,
|
|
NmiProcessor,
|
|
NmiSource,
|
|
NmiSource,
|
|
Polarity,
|
|
Polarity,
|
|
|
|
+ Processor,
|
|
|
|
+ ProcessorInfo,
|
|
|
|
+ ProcessorState,
|
|
TriggerMode,
|
|
TriggerMode,
|
|
},
|
|
},
|
|
sdt::SdtHeader,
|
|
sdt::SdtHeader,
|
|
- Acpi,
|
|
|
|
AcpiError,
|
|
AcpiError,
|
|
AcpiHandler,
|
|
AcpiHandler,
|
|
PhysicalMapping,
|
|
PhysicalMapping,
|
|
- Processor,
|
|
|
|
- ProcessorState,
|
|
|
|
};
|
|
};
|
|
use alloc::vec::Vec;
|
|
use alloc::vec::Vec;
|
|
use bit_field::BitField;
|
|
use bit_field::BitField;
|
|
@@ -40,14 +41,14 @@ pub enum MadtError {
|
|
/// * The Streamlined Advanced Programmable Interrupt Controller (SAPIC) model
|
|
/// * The Streamlined Advanced Programmable Interrupt Controller (SAPIC) model
|
|
/// * The Generic Interrupt Controller (GIC) model (ARM systems only)
|
|
/// * The Generic Interrupt Controller (GIC) model (ARM systems only)
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-pub(crate) struct Madt {
|
|
|
|
|
|
+pub struct Madt {
|
|
header: SdtHeader,
|
|
header: SdtHeader,
|
|
local_apic_address: u32,
|
|
local_apic_address: u32,
|
|
flags: u32,
|
|
flags: u32,
|
|
}
|
|
}
|
|
|
|
|
|
impl Madt {
|
|
impl Madt {
|
|
- fn entries(&self) -> MadtEntryIter {
|
|
|
|
|
|
+ pub fn entries(&self) -> MadtEntryIter {
|
|
MadtEntryIter {
|
|
MadtEntryIter {
|
|
pointer: unsafe { (self as *const Madt as *const u8).offset(mem::size_of::<Madt>() as isize) },
|
|
pointer: unsafe { (self as *const Madt as *const u8).offset(mem::size_of::<Madt>() as isize) },
|
|
remaining_length: self.header.length - mem::size_of::<Madt>() as u32,
|
|
remaining_length: self.header.length - mem::size_of::<Madt>() as u32,
|
|
@@ -55,12 +56,177 @@ impl Madt {
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
- fn supports_8259(&self) -> bool {
|
|
|
|
|
|
+ pub fn supports_8259(&self) -> bool {
|
|
unsafe { self.flags.get_bit(0) }
|
|
unsafe { self.flags.get_bit(0) }
|
|
}
|
|
}
|
|
|
|
+
|
|
|
|
+ pub fn parse_interrupt_model(&self) -> Result<(InterruptModel, Option<ProcessorInfo>), AcpiError> {
|
|
|
|
+ /*
|
|
|
|
+ * We first do a pass through the MADT to determine which interrupt model is being used.
|
|
|
|
+ */
|
|
|
|
+ for entry in self.entries() {
|
|
|
|
+ match entry {
|
|
|
|
+ MadtEntry::LocalApic(_) |
|
|
|
|
+ MadtEntry::IoApic(_) |
|
|
|
|
+ MadtEntry::InterruptSourceOverride(_) |
|
|
|
|
+ MadtEntry::NmiSource(_) | // TODO: is this one used by more than one model?
|
|
|
|
+ MadtEntry::LocalApicNmi(_) |
|
|
|
|
+ MadtEntry::LocalApicAddressOverride(_) => {
|
|
|
|
+ return self.parse_apic_model();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::IoSapic(_) |
|
|
|
|
+ MadtEntry::LocalSapic(_) |
|
|
|
|
+ MadtEntry::PlatformInterruptSource(_) => {
|
|
|
|
+ unimplemented!();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::LocalX2Apic(_) |
|
|
|
|
+ MadtEntry::X2ApicNmi(_) => {
|
|
|
|
+ unimplemented!();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::Gicc(_) |
|
|
|
|
+ MadtEntry::Gicd(_) |
|
|
|
|
+ MadtEntry::GicMsiFrame(_) |
|
|
|
|
+ MadtEntry::GicRedistributor(_) |
|
|
|
|
+ MadtEntry::GicInterruptTranslationService(_) => {
|
|
|
|
+ unimplemented!();
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ Ok((InterruptModel::Unknown, None))
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ pub fn parse_apic_model(&self) -> Result<(InterruptModel, Option<ProcessorInfo>), AcpiError> {
|
|
|
|
+ let mut local_apic_address = self.local_apic_address as u64;
|
|
|
|
+ let mut io_apic_count = 0;
|
|
|
|
+ let mut iso_count = 0;
|
|
|
|
+ let mut nmi_source_count = 0;
|
|
|
|
+ let mut local_nmi_line_count = 0;
|
|
|
|
+ let mut processor_count = 0usize;
|
|
|
|
+
|
|
|
|
+ // Do a pass over the entries so we know how much space we should reserve in the vectors
|
|
|
|
+ for entry in self.entries() {
|
|
|
|
+ match entry {
|
|
|
|
+ MadtEntry::IoApic(_) => io_apic_count += 1,
|
|
|
|
+ MadtEntry::InterruptSourceOverride(_) => iso_count += 1,
|
|
|
|
+ MadtEntry::NmiSource(_) => nmi_source_count += 1,
|
|
|
|
+ MadtEntry::LocalApicNmi(_) => local_nmi_line_count += 1,
|
|
|
|
+ MadtEntry::LocalApic(_) => processor_count += 1,
|
|
|
|
+ _ => (),
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ let mut io_apics = Vec::with_capacity(io_apic_count);
|
|
|
|
+ let mut interrupt_source_overrides = Vec::with_capacity(iso_count);
|
|
|
|
+ let mut nmi_sources = Vec::with_capacity(nmi_source_count);
|
|
|
|
+ let mut local_apic_nmi_lines = Vec::with_capacity(local_nmi_line_count);
|
|
|
|
+ let mut boot_processor = None;
|
|
|
|
+ let mut application_processors = Vec::with_capacity(processor_count.saturating_sub(1)); // Subtract one for the BSP
|
|
|
|
+
|
|
|
|
+ for entry in self.entries() {
|
|
|
|
+ match entry {
|
|
|
|
+ MadtEntry::LocalApic(ref entry) => {
|
|
|
|
+ /*
|
|
|
|
+ * The first processor is the BSP. Subsequent ones are APs. If we haven't found
|
|
|
|
+ * the BSP yet, this must be it.
|
|
|
|
+ */
|
|
|
|
+ let is_ap = boot_processor.is_some();
|
|
|
|
+ let is_disabled = !unsafe { entry.flags.get_bit(0) };
|
|
|
|
+
|
|
|
|
+ let state = match (is_ap, is_disabled) {
|
|
|
|
+ (_, true) => ProcessorState::Disabled,
|
|
|
|
+ (true, false) => ProcessorState::WaitingForSipi,
|
|
|
|
+ (false, false) => ProcessorState::Running,
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ let processor = Processor {
|
|
|
|
+ processor_uid: entry.processor_id,
|
|
|
|
+ local_apic_id: entry.apic_id,
|
|
|
|
+ state,
|
|
|
|
+ is_ap,
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ if is_ap {
|
|
|
|
+ application_processors.push(processor);
|
|
|
|
+ } else {
|
|
|
|
+ boot_processor = Some(processor);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::IoApic(ref entry) => {
|
|
|
|
+ io_apics.push(IoApic {
|
|
|
|
+ id: entry.io_apic_id,
|
|
|
|
+ address: entry.io_apic_address,
|
|
|
|
+ global_system_interrupt_base: entry.global_system_interrupt_base,
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::InterruptSourceOverride(ref entry) => {
|
|
|
|
+ if entry.bus != 0 {
|
|
|
|
+ return Err(AcpiError::InvalidMadt(MadtError::InterruptOverrideEntryHasInvalidBus));
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ let (polarity, trigger_mode) = parse_mps_inti_flags(entry.flags)?;
|
|
|
|
+
|
|
|
|
+ interrupt_source_overrides.push(InterruptSourceOverride {
|
|
|
|
+ isa_source: entry.irq,
|
|
|
|
+ global_system_interrupt: entry.global_system_interrupt,
|
|
|
|
+ polarity,
|
|
|
|
+ trigger_mode,
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::NmiSource(ref entry) => {
|
|
|
|
+ let (polarity, trigger_mode) = parse_mps_inti_flags(entry.flags)?;
|
|
|
|
+
|
|
|
|
+ nmi_sources.push(NmiSource {
|
|
|
|
+ global_system_interrupt: entry.global_system_interrupt,
|
|
|
|
+ polarity,
|
|
|
|
+ trigger_mode,
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::LocalApicNmi(ref entry) => local_apic_nmi_lines.push(NmiLine {
|
|
|
|
+ processor: if entry.processor_id == 0xff {
|
|
|
|
+ NmiProcessor::All
|
|
|
|
+ } else {
|
|
|
|
+ NmiProcessor::ProcessorUid(entry.processor_id as u32)
|
|
|
|
+ },
|
|
|
|
+ line: match entry.nmi_line {
|
|
|
|
+ 0 => LocalInterruptLine::Lint0,
|
|
|
|
+ 1 => LocalInterruptLine::Lint1,
|
|
|
|
+ _ => return Err(AcpiError::InvalidMadt(MadtError::InvalidLocalNmiLine)),
|
|
|
|
+ },
|
|
|
|
+ }),
|
|
|
|
+
|
|
|
|
+ MadtEntry::LocalApicAddressOverride(ref entry) => {
|
|
|
|
+ local_apic_address = entry.local_apic_address;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ _ => {
|
|
|
|
+ return Err(AcpiError::InvalidMadt(MadtError::UnexpectedEntry));
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ Ok((
|
|
|
|
+ InterruptModel::Apic(Apic {
|
|
|
|
+ local_apic_address,
|
|
|
|
+ io_apics,
|
|
|
|
+ local_apic_nmi_lines,
|
|
|
|
+ interrupt_source_overrides,
|
|
|
|
+ nmi_sources,
|
|
|
|
+ also_has_legacy_pics: self.supports_8259(),
|
|
|
|
+ }),
|
|
|
|
+ Some(ProcessorInfo { boot_processor: boot_processor.unwrap(), application_processors }),
|
|
|
|
+ ))
|
|
|
|
+ }
|
|
}
|
|
}
|
|
|
|
|
|
-struct MadtEntryIter<'a> {
|
|
|
|
|
|
+pub struct MadtEntryIter<'a> {
|
|
pointer: *const u8,
|
|
pointer: *const u8,
|
|
/*
|
|
/*
|
|
* The iterator can only have at most `u32::MAX` remaining bytes, because the length of the
|
|
* The iterator can only have at most `u32::MAX` remaining bytes, because the length of the
|
|
@@ -70,7 +236,7 @@ struct MadtEntryIter<'a> {
|
|
_phantom: PhantomData<&'a ()>,
|
|
_phantom: PhantomData<&'a ()>,
|
|
}
|
|
}
|
|
|
|
|
|
-enum MadtEntry<'a> {
|
|
|
|
|
|
+pub enum MadtEntry<'a> {
|
|
LocalApic(&'a LocalApicEntry),
|
|
LocalApic(&'a LocalApicEntry),
|
|
IoApic(&'a IoApicEntry),
|
|
IoApic(&'a IoApicEntry),
|
|
InterruptSourceOverride(&'a InterruptSourceOverrideEntry),
|
|
InterruptSourceOverride(&'a InterruptSourceOverrideEntry),
|
|
@@ -158,13 +324,13 @@ impl<'a> Iterator for MadtEntryIter<'a> {
|
|
|
|
|
|
#[derive(Clone, Copy)]
|
|
#[derive(Clone, Copy)]
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct EntryHeader {
|
|
|
|
|
|
+pub struct EntryHeader {
|
|
entry_type: u8,
|
|
entry_type: u8,
|
|
length: u8,
|
|
length: u8,
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct LocalApicEntry {
|
|
|
|
|
|
+pub struct LocalApicEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
processor_id: u8,
|
|
processor_id: u8,
|
|
apic_id: u8,
|
|
apic_id: u8,
|
|
@@ -172,7 +338,7 @@ struct LocalApicEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct IoApicEntry {
|
|
|
|
|
|
+pub struct IoApicEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
io_apic_id: u8,
|
|
io_apic_id: u8,
|
|
_reserved: u8,
|
|
_reserved: u8,
|
|
@@ -181,7 +347,7 @@ struct IoApicEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct InterruptSourceOverrideEntry {
|
|
|
|
|
|
+pub struct InterruptSourceOverrideEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
bus: u8, // 0 - ISA bus
|
|
bus: u8, // 0 - ISA bus
|
|
irq: u8, // This is bus-relative
|
|
irq: u8, // This is bus-relative
|
|
@@ -190,14 +356,14 @@ struct InterruptSourceOverrideEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct NmiSourceEntry {
|
|
|
|
|
|
+pub struct NmiSourceEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
flags: u16,
|
|
flags: u16,
|
|
global_system_interrupt: u32,
|
|
global_system_interrupt: u32,
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct LocalApicNmiEntry {
|
|
|
|
|
|
+pub struct LocalApicNmiEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
processor_id: u8,
|
|
processor_id: u8,
|
|
flags: u16,
|
|
flags: u16,
|
|
@@ -205,7 +371,7 @@ struct LocalApicNmiEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct LocalApicAddressOverrideEntry {
|
|
|
|
|
|
+pub struct LocalApicAddressOverrideEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
_reserved: u16,
|
|
_reserved: u16,
|
|
local_apic_address: u64,
|
|
local_apic_address: u64,
|
|
@@ -214,7 +380,7 @@ struct LocalApicAddressOverrideEntry {
|
|
/// If this entry is present, the system has an I/O SAPIC, which must be used instead of the I/O
|
|
/// If this entry is present, the system has an I/O SAPIC, which must be used instead of the I/O
|
|
/// APIC.
|
|
/// APIC.
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct IoSapicEntry {
|
|
|
|
|
|
+pub struct IoSapicEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
io_apic_id: u8,
|
|
io_apic_id: u8,
|
|
_reserved: u8,
|
|
_reserved: u8,
|
|
@@ -223,7 +389,7 @@ struct IoSapicEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct LocalSapicEntry {
|
|
|
|
|
|
+pub struct LocalSapicEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
processor_id: u8,
|
|
processor_id: u8,
|
|
local_sapic_id: u8,
|
|
local_sapic_id: u8,
|
|
@@ -240,7 +406,7 @@ struct LocalSapicEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct PlatformInterruptSourceEntry {
|
|
|
|
|
|
+pub struct PlatformInterruptSourceEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
flags: u16,
|
|
flags: u16,
|
|
interrupt_type: u8,
|
|
interrupt_type: u8,
|
|
@@ -252,7 +418,7 @@ struct PlatformInterruptSourceEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct LocalX2ApicEntry {
|
|
|
|
|
|
+pub struct LocalX2ApicEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
_reserved: u16,
|
|
_reserved: u16,
|
|
x2apic_id: u32,
|
|
x2apic_id: u32,
|
|
@@ -261,7 +427,7 @@ struct LocalX2ApicEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct X2ApicNmiEntry {
|
|
|
|
|
|
+pub struct X2ApicNmiEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
flags: u16,
|
|
flags: u16,
|
|
processor_uid: u32,
|
|
processor_uid: u32,
|
|
@@ -273,7 +439,7 @@ struct X2ApicNmiEntry {
|
|
/// Controller. In the GICC interrupt model, each logical process has a Processor Device object in
|
|
/// Controller. In the GICC interrupt model, each logical process has a Processor Device object in
|
|
/// the namespace, and uses this structure to convey its GIC information.
|
|
/// the namespace, and uses this structure to convey its GIC information.
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct GiccEntry {
|
|
|
|
|
|
+pub struct GiccEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
_reserved1: u16,
|
|
_reserved1: u16,
|
|
cpu_interface_number: u32,
|
|
cpu_interface_number: u32,
|
|
@@ -292,7 +458,7 @@ struct GiccEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct GicdEntry {
|
|
|
|
|
|
+pub struct GicdEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
_reserved1: u16,
|
|
_reserved1: u16,
|
|
gic_id: u32,
|
|
gic_id: u32,
|
|
@@ -311,7 +477,7 @@ struct GicdEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct GicMsiFrameEntry {
|
|
|
|
|
|
+pub struct GicMsiFrameEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
_reserved: u16,
|
|
_reserved: u16,
|
|
frame_id: u32,
|
|
frame_id: u32,
|
|
@@ -322,7 +488,7 @@ struct GicMsiFrameEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct GicRedistributorEntry {
|
|
|
|
|
|
+pub struct GicRedistributorEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
_reserved: u16,
|
|
_reserved: u16,
|
|
discovery_range_base_address: u64,
|
|
discovery_range_base_address: u64,
|
|
@@ -330,7 +496,7 @@ struct GicRedistributorEntry {
|
|
}
|
|
}
|
|
|
|
|
|
#[repr(C, packed)]
|
|
#[repr(C, packed)]
|
|
-struct GicInterruptTranslationServiceEntry {
|
|
|
|
|
|
+pub struct GicInterruptTranslationServiceEntry {
|
|
header: EntryHeader,
|
|
header: EntryHeader,
|
|
_reserved1: u16,
|
|
_reserved1: u16,
|
|
id: u32,
|
|
id: u32,
|
|
@@ -338,187 +504,6 @@ struct GicInterruptTranslationServiceEntry {
|
|
_reserved2: u32,
|
|
_reserved2: u32,
|
|
}
|
|
}
|
|
|
|
|
|
-pub(crate) fn parse_madt<H>(
|
|
|
|
- acpi: &mut Acpi,
|
|
|
|
- _handler: &mut H,
|
|
|
|
- mapping: &PhysicalMapping<Madt>,
|
|
|
|
-) -> Result<(), AcpiError>
|
|
|
|
-where
|
|
|
|
- H: AcpiHandler,
|
|
|
|
-{
|
|
|
|
- (*mapping).header.validate(crate::sdt::Signature::MADT)?;
|
|
|
|
-
|
|
|
|
- /*
|
|
|
|
- * If the MADT doesn't contain another supported interrupt model (either APIC, SAPIC, X2APIC
|
|
|
|
- * or GIC), and the system supports the legacy i8259 PIC, recommend that.
|
|
|
|
- * TODO: It's not clear how trustworthy this field is - should we be relying on it in any
|
|
|
|
- * way?
|
|
|
|
- */
|
|
|
|
- if (*mapping).supports_8259() {
|
|
|
|
- acpi.interrupt_model = Some(InterruptModel::Pic);
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- /*
|
|
|
|
- * We first do a pass through the MADT to determine which interrupt model is being used.
|
|
|
|
- */
|
|
|
|
- for entry in (*mapping).entries() {
|
|
|
|
- match entry {
|
|
|
|
- MadtEntry::LocalApic(_) |
|
|
|
|
- MadtEntry::IoApic(_) |
|
|
|
|
- MadtEntry::InterruptSourceOverride(_) |
|
|
|
|
- MadtEntry::NmiSource(_) | // TODO: is this one used by more than one model?
|
|
|
|
- MadtEntry::LocalApicNmi(_) |
|
|
|
|
- MadtEntry::LocalApicAddressOverride(_) => {
|
|
|
|
- acpi.interrupt_model = Some(parse_apic_model(acpi, mapping)?);
|
|
|
|
- break;
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- MadtEntry::IoSapic(_) |
|
|
|
|
- MadtEntry::LocalSapic(_) |
|
|
|
|
- MadtEntry::PlatformInterruptSource(_) => {
|
|
|
|
- unimplemented!();
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- MadtEntry::LocalX2Apic(_) |
|
|
|
|
- MadtEntry::X2ApicNmi(_) => {
|
|
|
|
- unimplemented!();
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- MadtEntry::Gicc(_) |
|
|
|
|
- MadtEntry::Gicd(_) |
|
|
|
|
- MadtEntry::GicMsiFrame(_) |
|
|
|
|
- MadtEntry::GicRedistributor(_) |
|
|
|
|
- MadtEntry::GicInterruptTranslationService(_) => {
|
|
|
|
- unimplemented!();
|
|
|
|
- }
|
|
|
|
- }
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- Ok(())
|
|
|
|
-}
|
|
|
|
-
|
|
|
|
-/// This parses the MADT and gathers information about a APIC interrupt model. We error if we
|
|
|
|
-/// encounter an entry that doesn't configure the APIC.
|
|
|
|
-fn parse_apic_model(acpi: &mut Acpi, mapping: &PhysicalMapping<Madt>) -> Result<InterruptModel, AcpiError> {
|
|
|
|
- use crate::interrupt::LocalInterruptLine;
|
|
|
|
-
|
|
|
|
- let mut local_apic_address = (*mapping).local_apic_address as u64;
|
|
|
|
- let mut io_apic_count = 0;
|
|
|
|
- let mut iso_count = 0;
|
|
|
|
- let mut nmi_source_count = 0;
|
|
|
|
- let mut local_nmi_line_count = 0;
|
|
|
|
- let mut processor_count = 0usize;
|
|
|
|
-
|
|
|
|
- // Do a pass over the entries so we know how much space we should reserve in the vectors
|
|
|
|
- for entry in (*mapping).entries() {
|
|
|
|
- match entry {
|
|
|
|
- MadtEntry::IoApic(_) => io_apic_count += 1,
|
|
|
|
- MadtEntry::InterruptSourceOverride(_) => iso_count += 1,
|
|
|
|
- MadtEntry::NmiSource(_) => nmi_source_count += 1,
|
|
|
|
- MadtEntry::LocalApicNmi(_) => local_nmi_line_count += 1,
|
|
|
|
- MadtEntry::LocalApic(_) => processor_count += 1,
|
|
|
|
- _ => (),
|
|
|
|
- }
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- let mut io_apics = Vec::with_capacity(io_apic_count);
|
|
|
|
- let mut interrupt_source_overrides = Vec::with_capacity(iso_count);
|
|
|
|
- let mut nmi_sources = Vec::with_capacity(nmi_source_count);
|
|
|
|
- let mut local_apic_nmi_lines = Vec::with_capacity(local_nmi_line_count);
|
|
|
|
- acpi.application_processors = Vec::with_capacity(processor_count.saturating_sub(1)); // Subtract one for the BSP
|
|
|
|
-
|
|
|
|
- for entry in (*mapping).entries() {
|
|
|
|
- match entry {
|
|
|
|
- MadtEntry::LocalApic(ref entry) => {
|
|
|
|
- /*
|
|
|
|
- * The first processor is the BSP. Subsequent ones are APs. If we haven't found
|
|
|
|
- * the BSP yet, this must be it.
|
|
|
|
- */
|
|
|
|
- let is_ap = acpi.boot_processor.is_some();
|
|
|
|
- let is_disabled = !unsafe { entry.flags.get_bit(0) };
|
|
|
|
-
|
|
|
|
- let state = match (is_ap, is_disabled) {
|
|
|
|
- (_, true) => ProcessorState::Disabled,
|
|
|
|
- (true, false) => ProcessorState::WaitingForSipi,
|
|
|
|
- (false, false) => ProcessorState::Running,
|
|
|
|
- };
|
|
|
|
-
|
|
|
|
- let processor =
|
|
|
|
- Processor { processor_uid: entry.processor_id, local_apic_id: entry.apic_id, state, is_ap };
|
|
|
|
-
|
|
|
|
- if is_ap {
|
|
|
|
- acpi.application_processors.push(processor);
|
|
|
|
- } else {
|
|
|
|
- acpi.boot_processor = Some(processor);
|
|
|
|
- }
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- MadtEntry::IoApic(ref entry) => {
|
|
|
|
- io_apics.push(IoApic {
|
|
|
|
- id: entry.io_apic_id,
|
|
|
|
- address: entry.io_apic_address,
|
|
|
|
- global_system_interrupt_base: entry.global_system_interrupt_base,
|
|
|
|
- });
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- MadtEntry::InterruptSourceOverride(ref entry) => {
|
|
|
|
- if entry.bus != 0 {
|
|
|
|
- return Err(AcpiError::InvalidMadt(MadtError::InterruptOverrideEntryHasInvalidBus));
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- let (polarity, trigger_mode) = parse_mps_inti_flags(entry.flags)?;
|
|
|
|
-
|
|
|
|
- interrupt_source_overrides.push(InterruptSourceOverride {
|
|
|
|
- isa_source: entry.irq,
|
|
|
|
- global_system_interrupt: entry.global_system_interrupt,
|
|
|
|
- polarity,
|
|
|
|
- trigger_mode,
|
|
|
|
- });
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- MadtEntry::NmiSource(ref entry) => {
|
|
|
|
- let (polarity, trigger_mode) = parse_mps_inti_flags(entry.flags)?;
|
|
|
|
-
|
|
|
|
- nmi_sources.push(NmiSource {
|
|
|
|
- global_system_interrupt: entry.global_system_interrupt,
|
|
|
|
- polarity,
|
|
|
|
- trigger_mode,
|
|
|
|
- });
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- MadtEntry::LocalApicNmi(ref entry) => local_apic_nmi_lines.push(NmiLine {
|
|
|
|
- processor: if entry.processor_id == 0xff {
|
|
|
|
- NmiProcessor::All
|
|
|
|
- } else {
|
|
|
|
- NmiProcessor::ProcessorUid(entry.processor_id as u32)
|
|
|
|
- },
|
|
|
|
- line: match entry.nmi_line {
|
|
|
|
- 0 => LocalInterruptLine::Lint0,
|
|
|
|
- 1 => LocalInterruptLine::Lint1,
|
|
|
|
- _ => return Err(AcpiError::InvalidMadt(MadtError::InvalidLocalNmiLine)),
|
|
|
|
- },
|
|
|
|
- }),
|
|
|
|
-
|
|
|
|
- MadtEntry::LocalApicAddressOverride(ref entry) => {
|
|
|
|
- local_apic_address = entry.local_apic_address;
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- _ => {
|
|
|
|
- return Err(AcpiError::InvalidMadt(MadtError::UnexpectedEntry));
|
|
|
|
- }
|
|
|
|
- }
|
|
|
|
- }
|
|
|
|
-
|
|
|
|
- Ok(InterruptModel::Apic(Apic {
|
|
|
|
- local_apic_address,
|
|
|
|
- io_apics,
|
|
|
|
- local_apic_nmi_lines,
|
|
|
|
- interrupt_source_overrides,
|
|
|
|
- nmi_sources,
|
|
|
|
- also_has_legacy_pics: (*mapping).supports_8259(),
|
|
|
|
- }))
|
|
|
|
-}
|
|
|
|
-
|
|
|
|
fn parse_mps_inti_flags(flags: u16) -> Result<(Polarity, TriggerMode), AcpiError> {
|
|
fn parse_mps_inti_flags(flags: u16) -> Result<(Polarity, TriggerMode), AcpiError> {
|
|
let polarity = match flags.get_bits(0..2) {
|
|
let polarity = match flags.get_bits(0..2) {
|
|
0b00 => Polarity::SameAsBus,
|
|
0b00 => Polarity::SameAsBus,
|