|
@@ -0,0 +1,506 @@
|
|
|
|
+use alloc::vec::Vec;
|
|
|
|
+use bit_field::BitField;
|
|
|
|
+use core::marker::PhantomData;
|
|
|
|
+use core::mem;
|
|
|
|
+use interrupt::{
|
|
|
|
+ InterruptModel, InterruptSourceOverride, IoApic, NmiSource, Polarity, TriggerMode,
|
|
|
|
+};
|
|
|
|
+use sdt::SdtHeader;
|
|
|
|
+use {Acpi, AcpiError, AcpiHandler, PhysicalMapping, Processor, ProcessorState};
|
|
|
|
+
|
|
|
|
+#[derive(Debug)]
|
|
|
|
+pub enum MadtError {
|
|
|
|
+ UnexpectedEntry,
|
|
|
|
+ InterruptOverrideEntryHasInvalidBus,
|
|
|
|
+ InvalidLocalNmiLine,
|
|
|
|
+ NoLocalNmiLineSpecified,
|
|
|
|
+ MpsIntiInvalidPolarity,
|
|
|
|
+ MpsIntiInvalidTriggerMode,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+/// Represents the MADT - this contains the MADT header fields. You can then iterate over a `Madt`
|
|
|
|
+/// to read each entry from it.
|
|
|
|
+///
|
|
|
|
+/// In modern versions of ACPI, the MADT can detail one of four interrupt models:
|
|
|
|
+/// * The ancient dual-i8259 legacy PIC model
|
|
|
|
+/// * The Advanced Programmable Interrupt Controller (APIC) model
|
|
|
|
+/// * The Streamlined Advanced Programmable Interrupt Controller (SAPIC) model
|
|
|
|
+/// * The Generic Interrupt Controller (GIC) model (ARM systems only)
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+pub(crate) struct Madt {
|
|
|
|
+ header: SdtHeader,
|
|
|
|
+ local_apic_address: u32,
|
|
|
|
+ flags: u32,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+impl Madt {
|
|
|
|
+ fn entries(&self) -> MadtEntryIter {
|
|
|
|
+ MadtEntryIter {
|
|
|
|
+ pointer: unsafe {
|
|
|
|
+ (self as *const Madt as *const u8).offset(mem::size_of::<Madt>() as isize)
|
|
|
|
+ },
|
|
|
|
+ remaining_length: self.header.length() - mem::size_of::<Madt>() as u32,
|
|
|
|
+ _phantom: PhantomData,
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ fn supports_8259(&self) -> bool {
|
|
|
|
+ unsafe { self.flags.get_bit(0) }
|
|
|
|
+ }
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+struct MadtEntryIter<'a> {
|
|
|
|
+ pointer: *const u8,
|
|
|
|
+ /*
|
|
|
|
+ * The iterator can only have at most `u32::MAX` remaining bytes, because the length of the
|
|
|
|
+ * whole SDT can only be at most `u32::MAX`.
|
|
|
|
+ */
|
|
|
|
+ remaining_length: u32,
|
|
|
|
+ _phantom: PhantomData<&'a ()>,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+enum MadtEntry<'a> {
|
|
|
|
+ LocalApic(&'a LocalApicEntry),
|
|
|
|
+ IoApic(&'a IoApicEntry),
|
|
|
|
+ InterruptSourceOverride(&'a InterruptSourceOverrideEntry),
|
|
|
|
+ NmiSource(&'a NmiSourceEntry),
|
|
|
|
+ LocalApicNmi(&'a LocalApicNmiEntry),
|
|
|
|
+ LocalApicAddressOverride(&'a LocalApicAddressOverrideEntry),
|
|
|
|
+ IoSapic(&'a IoSapicEntry),
|
|
|
|
+ LocalSapic(&'a LocalSapicEntry),
|
|
|
|
+ PlatformInterruptSource(&'a PlatformInterruptSourceEntry),
|
|
|
|
+ LocalX2Apic(&'a LocalX2ApicEntry),
|
|
|
|
+ X2ApicNmi(&'a X2ApicNmiEntry),
|
|
|
|
+ Gicc(&'a GiccEntry),
|
|
|
|
+ Gicd(&'a GicdEntry),
|
|
|
|
+ GicMsiFrame(&'a GicMsiFrameEntry),
|
|
|
|
+ GicRedistributor(&'a GicRedistributorEntry),
|
|
|
|
+ GicInterruptTranslationService(&'a GicInterruptTranslationServiceEntry),
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+impl<'a> Iterator for MadtEntryIter<'a> {
|
|
|
|
+ type Item = MadtEntry<'a>;
|
|
|
|
+
|
|
|
|
+ fn next(&mut self) -> Option<Self::Item> {
|
|
|
|
+ while self.remaining_length > 0 {
|
|
|
|
+ let entry_pointer = self.pointer;
|
|
|
|
+ let header = unsafe { *(self.pointer as *const EntryHeader) };
|
|
|
|
+
|
|
|
|
+ self.pointer = unsafe { self.pointer.offset(header.length as isize) };
|
|
|
|
+ self.remaining_length -= header.length as u32;
|
|
|
|
+
|
|
|
|
+ macro_rules! construct_entry {
|
|
|
|
+ ($entry_type:expr,
|
|
|
|
+ $entry_pointer:expr,
|
|
|
|
+ $(($value:expr => $variant:path as $type:ty)),*
|
|
|
|
+ ) => {
|
|
|
|
+ match $entry_type {
|
|
|
|
+ $(
|
|
|
|
+ $value => {
|
|
|
|
+ return Some($variant(unsafe {
|
|
|
|
+ &*($entry_pointer as *const $type)
|
|
|
|
+ }))
|
|
|
|
+ }
|
|
|
|
+ )*
|
|
|
|
+
|
|
|
|
+ /*
|
|
|
|
+ * These entry types are reserved by the ACPI standard. We should skip them
|
|
|
|
+ * if they appear in a real MADT.
|
|
|
|
+ */
|
|
|
|
+ 0x10..=0x7f => {}
|
|
|
|
+
|
|
|
|
+ /*
|
|
|
|
+ * These entry types are reserved for OEM use. Atm, we just skip them too.
|
|
|
|
+ * TODO: work out if we should ever do anything else here
|
|
|
|
+ */
|
|
|
|
+ 0x80..=0xff => {}
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ #[rustfmt::skip]
|
|
|
|
+ construct_entry!(
|
|
|
|
+ header.entry_type,
|
|
|
|
+ entry_pointer,
|
|
|
|
+ (0x0 => MadtEntry::LocalApic as LocalApicEntry),
|
|
|
|
+ (0x1 => MadtEntry::IoApic as IoApicEntry),
|
|
|
|
+ (0x2 => MadtEntry::InterruptSourceOverride as InterruptSourceOverrideEntry),
|
|
|
|
+ (0x3 => MadtEntry::NmiSource as NmiSourceEntry),
|
|
|
|
+ (0x4 => MadtEntry::LocalApicNmi as LocalApicNmiEntry),
|
|
|
|
+ (0x5 => MadtEntry::LocalApicAddressOverride as LocalApicAddressOverrideEntry),
|
|
|
|
+ (0x6 => MadtEntry::IoSapic as IoSapicEntry),
|
|
|
|
+ (0x7 => MadtEntry::LocalSapic as LocalSapicEntry),
|
|
|
|
+ (0x8 => MadtEntry::PlatformInterruptSource as PlatformInterruptSourceEntry),
|
|
|
|
+ (0x9 => MadtEntry::LocalX2Apic as LocalX2ApicEntry),
|
|
|
|
+ (0xa => MadtEntry::X2ApicNmi as X2ApicNmiEntry),
|
|
|
|
+ (0xb => MadtEntry::Gicc as GiccEntry),
|
|
|
|
+ (0xc => MadtEntry::Gicd as GicdEntry),
|
|
|
|
+ (0xd => MadtEntry::GicMsiFrame as GicMsiFrameEntry),
|
|
|
|
+ (0xe => MadtEntry::GicRedistributor as GicRedistributorEntry),
|
|
|
|
+ (0xf => MadtEntry::GicInterruptTranslationService as GicInterruptTranslationServiceEntry)
|
|
|
|
+ );
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ None
|
|
|
|
+ }
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[derive(Clone, Copy)]
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct EntryHeader {
|
|
|
|
+ entry_type: u8,
|
|
|
|
+ length: u8,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct LocalApicEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ processor_id: u8,
|
|
|
|
+ apic_id: u8,
|
|
|
|
+ flags: u32,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct IoApicEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ io_apic_id: u8,
|
|
|
|
+ _reserved: u8,
|
|
|
|
+ io_apic_address: u32,
|
|
|
|
+ global_system_interrupt_base: u32,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct InterruptSourceOverrideEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ bus: u8, // 0 - ISA bus
|
|
|
|
+ irq: u8, // This is bus-relative
|
|
|
|
+ global_system_interrupt: u32,
|
|
|
|
+ flags: u16,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct NmiSourceEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ flags: u16,
|
|
|
|
+ global_system_interrupt: u32,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct LocalApicNmiEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ processor_id: u8,
|
|
|
|
+ flags: u16,
|
|
|
|
+ nmi_line: u8, // Describes which LINTn is the NMI connected to
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct LocalApicAddressOverrideEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ _reserved: u16,
|
|
|
|
+ local_apic_address: u64,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+/// If this entry is present, the system has an I/O SAPIC, which must be used instead of the I/O APIC.
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct IoSapicEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ io_apic_id: u8,
|
|
|
|
+ _reserved: u8,
|
|
|
|
+ global_system_interrupt_base: u32,
|
|
|
|
+ io_sapic_address: u64,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct LocalSapicEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ processor_id: u8,
|
|
|
|
+ local_sapic_id: u8,
|
|
|
|
+ local_sapic_eid: u8,
|
|
|
|
+ _reserved: [u8; 3],
|
|
|
|
+ flags: u32,
|
|
|
|
+ processor_uid: u32,
|
|
|
|
+
|
|
|
|
+ /// This string can be used to associate this local SAPIC to a processor defined in the
|
|
|
|
+ /// namespace when the `_UID` object is a string. It is a null-terminated ASCII string, and so
|
|
|
|
+ /// this field will be `'\0'` if the string is not present, otherwise it extends from the
|
|
|
|
+ /// address of this field.
|
|
|
|
+ processor_uid_string: u8,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct PlatformInterruptSourceEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ flags: u16,
|
|
|
|
+ interrupt_type: u8,
|
|
|
|
+ processor_id: u8,
|
|
|
|
+ processor_eid: u8,
|
|
|
|
+ io_sapic_vector: u8,
|
|
|
|
+ global_system_interrupt: u32,
|
|
|
|
+ platform_interrupt_source_flags: u32,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct LocalX2ApicEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ _reserved: u16,
|
|
|
|
+ x2apic_id: u32,
|
|
|
|
+ flags: u32,
|
|
|
|
+ processor_uid: u32,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct X2ApicNmiEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ flags: u16,
|
|
|
|
+ processor_uid: u32,
|
|
|
|
+ nmi_line: u8,
|
|
|
|
+ _reserved: [u8; 3],
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+/// This field will appear for ARM processors that support ACPI and use the Generic Interrupt
|
|
|
|
+/// Controller. In the GICC interrupt model, each logical process has a Processor Device object in
|
|
|
|
+/// the namespace, and uses this structure to convey its GIC information.
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct GiccEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ _reserved1: u16,
|
|
|
|
+ cpu_interface_number: u32,
|
|
|
|
+ processor_uid: u32,
|
|
|
|
+ flags: u32,
|
|
|
|
+ parking_protocol_version: u32,
|
|
|
|
+ performance_interrupt_gsiv: u32,
|
|
|
|
+ parked_address: u64,
|
|
|
|
+ gic_registers_address: u64,
|
|
|
|
+ gic_control_block_address: u64,
|
|
|
|
+ vgic_maintenance_interrupt: u32,
|
|
|
|
+ gicr_base_address: u64,
|
|
|
|
+ mpidr: u64,
|
|
|
|
+ processor_power_efficiency_class: u8,
|
|
|
|
+ _reserved2: [u8; 3],
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct GicdEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ _reserved1: u16,
|
|
|
|
+ gic_id: u32,
|
|
|
|
+ physical_base_address: u64,
|
|
|
|
+ system_vector_base: u32,
|
|
|
|
+
|
|
|
|
+ /// The GIC version
|
|
|
|
+ /// 0x00: Fall back to hardware discovery
|
|
|
|
+ /// 0x01: GICv1
|
|
|
|
+ /// 0x02: GICv2
|
|
|
|
+ /// 0x03: GICv3
|
|
|
|
+ /// 0x04: GICv4
|
|
|
|
+ /// 0x05-0xff: Reserved for future use
|
|
|
|
+ gic_version: u8,
|
|
|
|
+ _reserved2: [u8; 3],
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct GicMsiFrameEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ _reserved: u16,
|
|
|
|
+ frame_id: u32,
|
|
|
|
+ physical_base_address: u64,
|
|
|
|
+ flags: u32,
|
|
|
|
+ spi_count: u16,
|
|
|
|
+ spi_base: u16,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct GicRedistributorEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ _reserved: u16,
|
|
|
|
+ discovery_range_base_address: u64,
|
|
|
|
+ discovery_range_length: u32,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+#[repr(C, packed)]
|
|
|
|
+struct GicInterruptTranslationServiceEntry {
|
|
|
|
+ header: EntryHeader,
|
|
|
|
+ _reserved1: u16,
|
|
|
|
+ id: u32,
|
|
|
|
+ physical_base_address: u64,
|
|
|
|
+ _reserved2: u32,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+pub(crate) fn parse_madt<H>(
|
|
|
|
+ acpi: &mut Acpi,
|
|
|
|
+ handler: &mut H,
|
|
|
|
+ mapping: &PhysicalMapping<Madt>,
|
|
|
|
+) -> Result<(), AcpiError>
|
|
|
|
+where
|
|
|
|
+ H: AcpiHandler,
|
|
|
|
+{
|
|
|
|
+ (*mapping).header.validate(b"APIC")?;
|
|
|
|
+
|
|
|
|
+ /*
|
|
|
|
+ * If the MADT doesn't contain another supported interrupt model (either APIC, SAPIC, X2APIC or
|
|
|
|
+ * GIC), and the system supports the legacy i8259 PIC, recommend that.
|
|
|
|
+ * TODO: It's not clear how trustworthy this field is - should we be relying on it in any way?
|
|
|
|
+ */
|
|
|
|
+ if (*mapping).supports_8259() {
|
|
|
|
+ acpi.interrupt_model = Some(InterruptModel::Pic);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /*
|
|
|
|
+ * We first do a pass through the MADT to determine which interrupt model is being used.
|
|
|
|
+ */
|
|
|
|
+ for entry in (*mapping).entries() {
|
|
|
|
+ match entry {
|
|
|
|
+ MadtEntry::LocalApic(_) |
|
|
|
|
+ MadtEntry::IoApic(_) |
|
|
|
|
+ MadtEntry::InterruptSourceOverride(_) |
|
|
|
|
+ MadtEntry::NmiSource(_) | // TODO: is this one used by more than one model?
|
|
|
|
+ MadtEntry::LocalApicNmi(_) |
|
|
|
|
+ MadtEntry::LocalApicAddressOverride(_) => {
|
|
|
|
+ acpi.interrupt_model = Some(parse_apic_model(acpi, mapping)?);
|
|
|
|
+ break;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::IoSapic(_) |
|
|
|
|
+ MadtEntry::LocalSapic(_) |
|
|
|
|
+ MadtEntry::PlatformInterruptSource(_) => {
|
|
|
|
+ unimplemented!();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::LocalX2Apic(_) |
|
|
|
|
+ MadtEntry::X2ApicNmi(_) => {
|
|
|
|
+ unimplemented!();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::Gicc(_) |
|
|
|
|
+ MadtEntry::Gicd(_) |
|
|
|
|
+ MadtEntry::GicMsiFrame(_) |
|
|
|
|
+ MadtEntry::GicRedistributor(_) |
|
|
|
|
+ MadtEntry::GicInterruptTranslationService(_) => {
|
|
|
|
+ unimplemented!();
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ Ok(())
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+/// This parses the MADT and gathers information about a APIC interrupt model. We error if we
|
|
|
|
+/// encounter an entry that doesn't configure the APIC.
|
|
|
|
+fn parse_apic_model(
|
|
|
|
+ acpi: &mut Acpi,
|
|
|
|
+ mapping: &PhysicalMapping<Madt>,
|
|
|
|
+) -> Result<InterruptModel, AcpiError> {
|
|
|
|
+ use interrupt::LocalInterruptLine;
|
|
|
|
+
|
|
|
|
+ let mut local_apic_address = (*mapping).local_apic_address as u64;
|
|
|
|
+ let mut io_apics = Vec::new();
|
|
|
|
+ let mut local_apic_nmi_line = None;
|
|
|
|
+ let mut interrupt_source_overrides = Vec::new();
|
|
|
|
+ let mut nmi_sources = Vec::new();
|
|
|
|
+
|
|
|
|
+ for entry in (*mapping).entries() {
|
|
|
|
+ match entry {
|
|
|
|
+ MadtEntry::LocalApic(ref entry) => {
|
|
|
|
+ /*
|
|
|
|
+ * The first processor is the BSP. Subsequent ones are APs. If we haven't found the
|
|
|
|
+ * BSP yet, this must be it.
|
|
|
|
+ */
|
|
|
|
+ let is_ap = acpi.boot_processor.is_some();
|
|
|
|
+ let is_disabled = !unsafe { entry.flags.get_bit(0) };
|
|
|
|
+
|
|
|
|
+ let state = match (is_ap, is_disabled) {
|
|
|
|
+ (_, true) => ProcessorState::Disabled,
|
|
|
|
+ (true, false) => ProcessorState::WaitingForSipi,
|
|
|
|
+ (false, false) => ProcessorState::Running,
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ let processor = Processor::new(entry.processor_id, entry.apic_id, state, is_ap);
|
|
|
|
+
|
|
|
|
+ if is_ap {
|
|
|
|
+ acpi.application_processors.push(processor);
|
|
|
|
+ } else {
|
|
|
|
+ acpi.boot_processor = Some(processor);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::IoApic(ref entry) => {
|
|
|
|
+ io_apics.push(IoApic {
|
|
|
|
+ id: entry.io_apic_id,
|
|
|
|
+ address: entry.io_apic_address,
|
|
|
|
+ global_system_interrupt_base: entry.global_system_interrupt_base,
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::InterruptSourceOverride(ref entry) => {
|
|
|
|
+ if entry.bus != 0 {
|
|
|
|
+ return Err(AcpiError::InvalidMadt(
|
|
|
|
+ MadtError::InterruptOverrideEntryHasInvalidBus,
|
|
|
|
+ ));
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ let (polarity, trigger_mode) = parse_mps_inti_flags(entry.flags)?;
|
|
|
|
+
|
|
|
|
+ interrupt_source_overrides.push(InterruptSourceOverride {
|
|
|
|
+ isa_source: entry.irq,
|
|
|
|
+ global_system_interrupt: entry.global_system_interrupt,
|
|
|
|
+ polarity,
|
|
|
|
+ trigger_mode,
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::NmiSource(ref entry) => {
|
|
|
|
+ let (polarity, trigger_mode) = parse_mps_inti_flags(entry.flags)?;
|
|
|
|
+
|
|
|
|
+ nmi_sources.push(NmiSource {
|
|
|
|
+ global_system_interrupt: entry.global_system_interrupt,
|
|
|
|
+ polarity,
|
|
|
|
+ trigger_mode,
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::LocalApicNmi(ref entry) => {
|
|
|
|
+ local_apic_nmi_line = Some(match entry.nmi_line {
|
|
|
|
+ 0 => LocalInterruptLine::Lint0,
|
|
|
|
+ 1 => LocalInterruptLine::Lint1,
|
|
|
|
+ _ => return Err(AcpiError::InvalidMadt(MadtError::InvalidLocalNmiLine)),
|
|
|
|
+ })
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ MadtEntry::LocalApicAddressOverride(ref entry) => {
|
|
|
|
+ local_apic_address = entry.local_apic_address;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ _ => {
|
|
|
|
+ return Err(AcpiError::InvalidMadt(MadtError::UnexpectedEntry));
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ Ok(InterruptModel::Apic {
|
|
|
|
+ local_apic_address,
|
|
|
|
+ io_apics,
|
|
|
|
+ local_apic_nmi_line: local_apic_nmi_line
|
|
|
|
+ .ok_or(AcpiError::InvalidMadt(MadtError::NoLocalNmiLineSpecified))?,
|
|
|
|
+ interrupt_source_overrides,
|
|
|
|
+ nmi_sources,
|
|
|
|
+ also_has_legacy_pics: (*mapping).supports_8259(),
|
|
|
|
+ })
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+fn parse_mps_inti_flags(flags: u16) -> Result<(Polarity, TriggerMode), AcpiError> {
|
|
|
|
+ let polarity = match flags.get_bits(0..2) {
|
|
|
|
+ 0b00 => Polarity::SameAsBus,
|
|
|
|
+ 0b01 => Polarity::ActiveHigh,
|
|
|
|
+ 0b11 => Polarity::ActiveLow,
|
|
|
|
+ _ => return Err(AcpiError::InvalidMadt(MadtError::MpsIntiInvalidPolarity)),
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ let trigger_mode = match flags.get_bits(2..4) {
|
|
|
|
+ 0b00 => TriggerMode::SameAsBus,
|
|
|
|
+ 0b01 => TriggerMode::Edge,
|
|
|
|
+ 0b11 => TriggerMode::Level,
|
|
|
|
+ _ => return Err(AcpiError::InvalidMadt(MadtError::MpsIntiInvalidTriggerMode)),
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ Ok((polarity, trigger_mode))
|
|
|
|
+}
|